C50H71ClN6O4 — CID 158134961
bis(3-[(3S)-3-(3-phenylmethoxypropyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine);hydrochloride (PubChem CID 158134961) has the molecular formula C50H71ClN6O4 and a molecular weight of 855.61 g/mol. Its IUPAC name is bis(3-[(3S)-3-(3-phenylmethoxypropyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine);hydrochloride.
| Compound Name | bis(3-[(3S)-3-(3-phenylmethoxypropyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine);hydrochloride |
|---|---|
| PubChem CID | 158134961 |
| Molecular Formula | C50H71ClN6O4 |
| Molecular Weight | 855.61 g/mol |
| Exact Mass | 854.52 |
| IUPAC Name | bis(3-[(3S)-3-(3-phenylmethoxypropyl)piperidin-1-yl]-5-[[(2S)-pyrrolidin-2-yl]methoxy]pyridine);hydrochloride |
| SMILES | Cl.c1ccc(COCCC[C@@H]2CCCN(c3cncc(OC[C@@H]4CCCN4)c3)C2)cc1.c1ccc(COCCC[C@@H]2CCCN(c3cncc(OC[C@@H]4CCCN4)c3)C2)cc1 |
| InChI | InChI=1S/2C25H35N3O2.ClH/c2*1-2-7-22(8-3-1)19-29-14-6-10-21-9-5-13-28(18-21)24-15-25(17-26-16-24)30-20-23-11-4-12-27-23;/h2*1-3,7-8,15-17,21,23,27H,4-6,9-14,18-20H2;1H/t2*21-,23-;/m00./s1 |
| InChIKey | AADOWJOHMFPXIF-HMUGCSRUSA-N |
| XLogP | 9.27 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.61 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|