C29H31FN4O5S2 — CID 158136153
2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-piperidin-1-ylpropylamino)-4H-isoquinoline-1,3-dione (PubChem CID 158136153) has the molecular formula C29H31FN4O5S2 and a molecular weight of 598.72 g/mol. Its IUPAC name is 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-piperidin-1-ylpropylamino)-4H-isoquinoline-1,3-dione.
| Compound Name | 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-piperidin-1-ylpropylamino)-4H-isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 158136153 |
| Molecular Formula | C29H31FN4O5S2 |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 2-[5-[3-(5-fluorothiophen-2-yl)sulfonyl-2-oxopropyl]-2-pyridinyl]-6-(3-piperidin-1-ylpropylamino)-4H-isoquinoline-1,3-dione |
| SMILES | O=C(Cc1ccc(N2C(=O)Cc3cc(NCCCN4CCCCC4)ccc3C2=O)nc1)CS(=O)(=O)c1ccc(F)s1 |
| InChI | InChI=1S/C29H31FN4O5S2/c30-25-8-10-28(40-25)41(38,39)19-23(35)15-20-5-9-26(32-18-20)34-27(36)17-21-16-22(6-7-24(21)29(34)37)31-11-4-14-33-12-2-1-3-13-33/h5-10,16,18,31H,1-4,11-15,17,19H2 |
| InChIKey | FYWGCAGNERGDJA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|