C19H19ClN2O6S2 — CID 158136867
(3R,4S)-1-(2-chloro-4-methylphenyl)sulfonyl-3-(hydroxymethyl)-4-(4-isocyanophenyl)sulfonylpyrrolidin-3-ol (PubChem CID 158136867) has the molecular formula C19H19ClN2O6S2 and a molecular weight of 470.96 g/mol. Its IUPAC name is (3R,4S)-1-(2-chloro-4-methylphenyl)sulfonyl-3-(hydroxymethyl)-4-(4-isocyanophenyl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R,4S)-1-(2-chloro-4-methylphenyl)sulfonyl-3-(hydroxymethyl)-4-(4-isocyanophenyl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 158136867 |
| Molecular Formula | C19H19ClN2O6S2 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | (3R,4S)-1-(2-chloro-4-methylphenyl)sulfonyl-3-(hydroxymethyl)-4-(4-isocyanophenyl)sulfonylpyrrolidin-3-ol |
| SMILES | [C-]#[N+]c1ccc(S(=O)(=O)[C@H]2CN(S(=O)(=O)c3ccc(C)cc3Cl)C[C@@]2(O)CO)cc1 |
| InChI | InChI=1S/C19H19ClN2O6S2/c1-13-3-8-17(16(20)9-13)30(27,28)22-10-18(19(24,11-22)12-23)29(25,26)15-6-4-14(21-2)5-7-15/h3-9,18,23-24H,10-12H2,1H3/t18-,19+/m0/s1 |
| InChIKey | FTLIFTVHYAPMQG-RBUKOAKNSA-N |
| XLogP | 1.77 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|