C7H9Cl3V — CID 158137341
1,3-dimethylcyclopenta-1,3-diene;vanadium(4+);trichloride (PubChem CID 158137341) has the molecular formula C7H9Cl3V and a molecular weight of 250.45 g/mol. Its IUPAC name is 1,3-dimethylcyclopenta-1,3-diene;vanadium(4+);trichloride.
| Compound Name | 1,3-dimethylcyclopenta-1,3-diene;vanadium(4+);trichloride |
|---|---|
| PubChem CID | 158137341 |
| Molecular Formula | C7H9Cl3V |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 248.92 |
| IUPAC Name | 1,3-dimethylcyclopenta-1,3-diene;vanadium(4+);trichloride |
| SMILES | CC1=[C-]C(C)=CC1.[Cl-].[Cl-].[Cl-].[V+4] |
| InChI | InChI=1S/C7H9.3ClH.V/c1-6-3-4-7(2)5-6;;;;/h3H,4H2,1-2H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | DCUYUZGXRHCMIS-UHFFFAOYSA-K |
| XLogP | -6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | -6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|