C22H35NO — CID 158137555
[4-(5,5-dimethylhexyl)piperidin-1-yl]-(3-ethylphenyl)methanone (PubChem CID 158137555) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is [4-(5,5-dimethylhexyl)piperidin-1-yl]-(3-ethylphenyl)methanone.
| Compound Name | [4-(5,5-dimethylhexyl)piperidin-1-yl]-(3-ethylphenyl)methanone |
|---|---|
| PubChem CID | 158137555 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | [4-(5,5-dimethylhexyl)piperidin-1-yl]-(3-ethylphenyl)methanone |
| SMILES | CCc1cccc(C(=O)N2CCC(CCCCC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C22H35NO/c1-5-18-10-8-11-20(17-18)21(24)23-15-12-19(13-16-23)9-6-7-14-22(2,3)4/h8,10-11,17,19H,5-7,9,12-16H2,1-4H3 |
| InChIKey | PXHRLDQNEZSVKB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|