C22H35NO5 — CID 15814003
(2S)-2-[(2S,6R)-2-(hydroxymethyl)-6-octoxymorpholin-4-yl]-3-phenylpropanoic acid (PubChem CID 15814003) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is (2S)-2-[(2S,6R)-2-(hydroxymethyl)-6-octoxymorpholin-4-yl]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(2S,6R)-2-(hydroxymethyl)-6-octoxymorpholin-4-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 15814003 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | (2S)-2-[(2S,6R)-2-(hydroxymethyl)-6-octoxymorpholin-4-yl]-3-phenylpropanoic acid |
| SMILES | CCCCCCCCO[C@H]1CN([C@@H](Cc2ccccc2)C(=O)O)C[C@@H](CO)O1 |
| InChI | InChI=1S/C22H35NO5/c1-2-3-4-5-6-10-13-27-21-16-23(15-19(17-24)28-21)20(22(25)26)14-18-11-8-7-9-12-18/h7-9,11-12,19-21,24H,2-6,10,13-17H2,1H3,(H,25,26)/t19-,20-,21+/m0/s1 |
| InChIKey | AFGQISVRLSWKBF-PCCBWWKXSA-N |
| XLogP | 3.08 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|