C22H26F6O4S2 — CID 158141868
2-(4-butoxynaphthalen-1-yl)thiolane;1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid (PubChem CID 158141868) has the molecular formula C22H26F6O4S2 and a molecular weight of 532.57 g/mol. Its IUPAC name is 2-(4-butoxynaphthalen-1-yl)thiolane;1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid.
| Compound Name | 2-(4-butoxynaphthalen-1-yl)thiolane;1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 158141868 |
| Molecular Formula | C22H26F6O4S2 |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 2-(4-butoxynaphthalen-1-yl)thiolane;1,1,2,2,3,3-hexafluorobutane-1-sulfonic acid |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O.CCCCOc1ccc(C2CCCS2)c2ccccc12 |
| InChI | InChI=1S/C18H22OS.C4H4F6O3S/c1-2-3-12-19-17-11-10-16(18-9-6-13-20-18)14-7-4-5-8-15(14)17;1-2(5,6)3(7,8)4(9,10)14(11,12)13/h4-5,7-8,10-11,18H,2-3,6,9,12-13H2,1H3;1H3,(H,11,12,13) |
| InChIKey | FUAQIWASHAOHAM-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|