C22H28N6O5Si — CID 158142665
methyl 2H-pyrazolo[3,4-b]pyridine-3-carboxylate;methyl 1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridine-3-carboxylate (PubChem CID 158142665) has the molecular formula C22H28N6O5Si and a molecular weight of 484.59 g/mol. Its IUPAC name is methyl 2H-pyrazolo[3,4-b]pyridine-3-carboxylate;methyl 1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridine-3-carboxylate.
| Compound Name | methyl 2H-pyrazolo[3,4-b]pyridine-3-carboxylate;methyl 1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 158142665 |
| Molecular Formula | C22H28N6O5Si |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | methyl 2H-pyrazolo[3,4-b]pyridine-3-carboxylate;methyl 1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridine-3-carboxylate |
| SMILES | COC(=O)c1[nH]nc2ncccc12.COC(=O)c1nn(COCC[Si](C)(C)C)c2ncccc12 |
| InChI | InChI=1S/C14H21N3O3Si.C8H7N3O2/c1-19-14(18)12-11-6-5-7-15-13(11)17(16-12)10-20-8-9-21(2,3)4;1-13-8(12)6-5-3-2-4-9-7(5)11-10-6/h5-7H,8-10H2,1-4H3;2-4H,1H3,(H,9,10,11) |
| InChIKey | FUDAWOZEUIAVGR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|