C15H20O3S — CID 15814381
methyl 1-[(4-methoxyphenyl)methylsulfanyl]cyclopentane-1-carboxylate (PubChem CID 15814381) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is methyl 1-[(4-methoxyphenyl)methylsulfanyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-[(4-methoxyphenyl)methylsulfanyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 15814381 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 1-[(4-methoxyphenyl)methylsulfanyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(SCc2ccc(OC)cc2)CCCC1 |
| InChI | InChI=1S/C15H20O3S/c1-17-13-7-5-12(6-8-13)11-19-15(14(16)18-2)9-3-4-10-15/h5-8H,3-4,9-11H2,1-2H3 |
| InChIKey | LRAQXCZYWMNOAJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |