C27H34O4S — CID 21216920
methyl 3-[1-[(4-methoxyphenyl)methylsulfanyl]cyclohexyl]-3-oxo-2-(2,4,6-trimethylphenyl)propanoate (PubChem CID 21216920) has the molecular formula C27H34O4S and a molecular weight of 454.63 g/mol. Its IUPAC name is methyl 3-[1-[(4-methoxyphenyl)methylsulfanyl]cyclohexyl]-3-oxo-2-(2,4,6-trimethylphenyl)propanoate.
| Compound Name | methyl 3-[1-[(4-methoxyphenyl)methylsulfanyl]cyclohexyl]-3-oxo-2-(2,4,6-trimethylphenyl)propanoate |
|---|---|
| PubChem CID | 21216920 |
| Molecular Formula | C27H34O4S |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | methyl 3-[1-[(4-methoxyphenyl)methylsulfanyl]cyclohexyl]-3-oxo-2-(2,4,6-trimethylphenyl)propanoate |
| SMILES | COC(=O)C(C(=O)C1(SCc2ccc(OC)cc2)CCCCC1)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C27H34O4S/c1-18-15-19(2)23(20(3)16-18)24(26(29)31-5)25(28)27(13-7-6-8-14-27)32-17-21-9-11-22(30-4)12-10-21/h9-12,15-16,24H,6-8,13-14,17H2,1-5H3 |
| InChIKey | RYHAVDACPNRIQW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|