C19H28N2O4S — CID 59756967
ethyl 2-formamido-2-[4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpiperidin-4-yl]acetate (PubChem CID 59756967) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is ethyl 2-formamido-2-[4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpiperidin-4-yl]acetate.
| Compound Name | ethyl 2-formamido-2-[4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 59756967 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | ethyl 2-formamido-2-[4-[(4-methoxyphenyl)methylsulfanyl]-1-methylpiperidin-4-yl]acetate |
| SMILES | CCOC(=O)C(NC=O)C1(SCc2ccc(OC)cc2)CCN(C)CC1 |
| InChI | InChI=1S/C19H28N2O4S/c1-4-25-18(23)17(20-14-22)19(9-11-21(2)12-10-19)26-13-15-5-7-16(24-3)8-6-15/h5-8,14,17H,4,9-13H2,1-3H3,(H,20,22) |
| InChIKey | XDUULDSZGVJRSD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|