C32H16Br2F4N4O5Se — CID 158144085
1-(7-bromo-1,5-naphthyridin-2-yl)-2-(3,4-difluorophenyl)ethane-1,2-dione;2-(7-bromo-1,5-naphthyridin-2-yl)-1-(3,4-difluorophenyl)ethanone;selenium dioxide (PubChem CID 158144085) has the molecular formula C32H16Br2F4N4O5Se and a molecular weight of 851.26 g/mol. Its IUPAC name is 1-(7-bromo-1,5-naphthyridin-2-yl)-2-(3,4-difluorophenyl)ethane-1,2-dione;2-(7-bromo-1,5-naphthyridin-2-yl)-1-(3,4-difluorophenyl)ethanone;selenium dioxide.
| Compound Name | 1-(7-bromo-1,5-naphthyridin-2-yl)-2-(3,4-difluorophenyl)ethane-1,2-dione;2-(7-bromo-1,5-naphthyridin-2-yl)-1-(3,4-difluorophenyl)ethanone;selenium dioxide |
|---|---|
| PubChem CID | 158144085 |
| Molecular Formula | C32H16Br2F4N4O5Se |
| Molecular Weight | 851.26 g/mol |
| Exact Mass | 849.86 |
| IUPAC Name | 1-(7-bromo-1,5-naphthyridin-2-yl)-2-(3,4-difluorophenyl)ethane-1,2-dione;2-(7-bromo-1,5-naphthyridin-2-yl)-1-(3,4-difluorophenyl)ethanone;selenium dioxide |
| SMILES | O=C(C(=O)c1ccc2ncc(Br)cc2n1)c1ccc(F)c(F)c1.O=C(Cc1ccc2ncc(Br)cc2n1)c1ccc(F)c(F)c1.O=[Se]=O |
| InChI | InChI=1S/C16H7BrF2N2O2.C16H9BrF2N2O.O2Se/c17-9-6-14-12(20-7-9)3-4-13(21-14)16(23)15(22)8-1-2-10(18)11(19)5-8;17-10-6-15-14(20-8-10)4-2-11(21-15)7-16(22)9-1-3-12(18)13(19)5-9;1-3-2/h1-7H;1-6,8H,7H2; |
| InChIKey | FUHJDNDHLJKOKC-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 136.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.26 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|