C18H22N2O3 — CID 158145950
7-[4-(phenylcarbamoyl)-1H-pyrrol-2-yl]heptanoic acid (PubChem CID 158145950) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 7-[4-(phenylcarbamoyl)-1H-pyrrol-2-yl]heptanoic acid.
| Compound Name | 7-[4-(phenylcarbamoyl)-1H-pyrrol-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 158145950 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 7-[4-(phenylcarbamoyl)-1H-pyrrol-2-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCc1cc(C(=O)Nc2ccccc2)c[nH]1 |
| InChI | InChI=1S/C18H22N2O3/c21-17(22)11-7-2-1-4-10-16-12-14(13-19-16)18(23)20-15-8-5-3-6-9-15/h3,5-6,8-9,12-13,19H,1-2,4,7,10-11H2,(H,20,23)(H,21,22) |
| InChIKey | IHHIQBGDIXDVAL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|