C42H35F6IN8O8 — CID 158154125
7-benzyl-3-ethyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione;7-benzyl-8-[3-(trifluoromethoxy)phenoxy]-3H-purine-2,6-dione;iodoethane (PubChem CID 158154125) has the molecular formula C42H35F6IN8O8 and a molecular weight of 1020.68 g/mol. Its IUPAC name is 7-benzyl-3-ethyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione;7-benzyl-8-[3-(trifluoromethoxy)phenoxy]-3H-purine-2,6-dione;iodoethane.
| Compound Name | 7-benzyl-3-ethyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione;7-benzyl-8-[3-(trifluoromethoxy)phenoxy]-3H-purine-2,6-dione;iodoethane |
|---|---|
| PubChem CID | 158154125 |
| Molecular Formula | C42H35F6IN8O8 |
| Molecular Weight | 1020.68 g/mol |
| Exact Mass | 1020.15 |
| IUPAC Name | 7-benzyl-3-ethyl-8-[3-(trifluoromethoxy)phenoxy]purine-2,6-dione;7-benzyl-8-[3-(trifluoromethoxy)phenoxy]-3H-purine-2,6-dione;iodoethane |
| SMILES | CCI.CCn1c(=O)[nH]c(=O)c2c1nc(Oc1cccc(OC(F)(F)F)c1)n2Cc1ccccc1.O=c1[nH]c(=O)c2c(nc(Oc3cccc(OC(F)(F)F)c3)n2Cc2ccccc2)[nH]1 |
| InChI | InChI=1S/C21H17F3N4O4.C19H13F3N4O4.C2H5I/c1-2-27-17-16(18(29)26-19(27)30)28(12-13-7-4-3-5-8-13)20(25-17)31-14-9-6-10-15(11-14)32-21(22,23)24;20-19(21,22)30-13-8-4-7-12(9-13)29-18-24-15-14(16(27)25-17(28)23-15)26(18)10-11-5-2-1-3-6-11;1-2-3/h3-11H,2,12H2,1H3,(H,26,29,30);1-9H,10H2,(H2,23,25,27,28);2H2,1H3 |
| InChIKey | FVLYBDVDPROPSG-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 193.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.68 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|