C33H46N4O7S — CID 158155897
methyl 3-amino-2-[2-[[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]-3-phenylprop-2-enoyl]adamantane-1-carboxylate (PubChem CID 158155897) has the molecular formula C33H46N4O7S and a molecular weight of 642.82 g/mol. Its IUPAC name is methyl 3-amino-2-[2-[[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]-3-phenylprop-2-enoyl]adamantane-1-carboxylate.
| Compound Name | methyl 3-amino-2-[2-[[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]-3-phenylprop-2-enoyl]adamantane-1-carboxylate |
|---|---|
| PubChem CID | 158155897 |
| Molecular Formula | C33H46N4O7S |
| Molecular Weight | 642.82 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | methyl 3-amino-2-[2-[[2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]-3-phenylprop-2-enoyl]adamantane-1-carboxylate |
| SMILES | COC(=O)C12CC3CC(CC(N)(C3)C1C(=O)C(=Cc1ccccc1)NC(=O)CNC(=O)[C@@H](CCSC)NC(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C33H46N4O7S/c1-31(2,3)44-30(42)37-23(11-12-45-5)28(40)35-19-25(38)36-24(14-20-9-7-6-8-10-20)26(39)27-32(29(41)43-4)15-21-13-22(16-32)18-33(27,34)17-21/h6-10,14,21-23,27H,11-13,15-19,34H2,1-5H3,(H,35,40)(H,36,38)(H,37,42)/t21?,22?,23-,27?,32?,33?/m1/s1 |
| InChIKey | FVRJPHBEDNHAMP-ZOWQZNFHSA-N |
| XLogP | 3.17 |
| TPSA | 165.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|