C25H20N2O5 — CID 15815881
3-methoxy-12-nitro-2-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one (PubChem CID 15815881) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is 3-methoxy-12-nitro-2-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one.
| Compound Name | 3-methoxy-12-nitro-2-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 15815881 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 3-methoxy-12-nitro-2-phenylmethoxy-5,6-dihydroisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES | COc1cc2c(cc1OCc1ccccc1)-c1cc3c([N+](=O)[O-])cccc3c(=O)n1CC2 |
| InChI | InChI=1S/C25H20N2O5/c1-31-23-12-17-10-11-26-22(13-20-18(25(26)28)8-5-9-21(20)27(29)30)19(17)14-24(23)32-15-16-6-3-2-4-7-16/h2-9,12-14H,10-11,15H2,1H3 |
| InChIKey | PPJKHRUYLKQOAI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 83.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|