C28H32N2O9 — CID 158158969
ethyl 2-[(4-methoxybenzoyl)amino]-3-oxobutanoate;ethyl 2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylate (PubChem CID 158158969) has the molecular formula C28H32N2O9 and a molecular weight of 540.57 g/mol. Its IUPAC name is ethyl 2-[(4-methoxybenzoyl)amino]-3-oxobutanoate;ethyl 2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[(4-methoxybenzoyl)amino]-3-oxobutanoate;ethyl 2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 158158969 |
| Molecular Formula | C28H32N2O9 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | ethyl 2-[(4-methoxybenzoyl)amino]-3-oxobutanoate;ethyl 2-(4-methoxyphenyl)-5-methyl-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)C(NC(=O)c1ccc(OC)cc1)C(C)=O.CCOC(=O)c1nc(-c2ccc(OC)cc2)oc1C |
| InChI | InChI=1S/C14H17NO5.C14H15NO4/c1-4-20-14(18)12(9(2)16)15-13(17)10-5-7-11(19-3)8-6-10;1-4-18-14(16)12-9(2)19-13(15-12)10-5-7-11(17-3)8-6-10/h5-8,12H,4H2,1-3H3,(H,15,17);5-8H,4H2,1-3H3 |
| InChIKey | FWANUWTVLPVGFX-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 143.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|