About ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate
ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate (PubChem CID 152807830) has the molecular formula C16H19NO4
and a molecular weight of 289.33 g/mol. Its IUPAC name is ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate |
| PubChem CID | 152807830 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(OC)cc2)oc1C(C)C |
| InChI | InChI=1S/C16H19NO4/c1-5-20-16(18)13-14(10(2)3)21-15(17-13)11-6-8-12(19-4)9-7-11/h6-10H,5H2,1-4H3 |
| InChIKey | SPVRIGDRXKWQES-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate (CID 152807830) is ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate is CCOC(=O)c1nc(-c2ccc(OC)cc2)oc1C(C)C.
What is the InChIKey of ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate?
The InChIKey is SPVRIGDRXKWQES-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4/c1-5-20-16(18)13-14(10(2)3)21-15(17-13)11-6-8-12(19-4)9-7-11/h6-10H,5H2,1-4H3.
What are the key properties of ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate?
ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate has a molecular weight of 289.33 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-methoxyphenyl)-5-propan-2-yl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 152807830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).