C14H14FNO4 — CID 42883064
ethyl 5-ethoxy-2-(4-fluorophenyl)-1,3-oxazole-4-carboxylate (PubChem CID 42883064) has the molecular formula C14H14FNO4 and a molecular weight of 279.27 g/mol. Its IUPAC name is ethyl 5-ethoxy-2-(4-fluorophenyl)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-ethoxy-2-(4-fluorophenyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 42883064 |
| Molecular Formula | C14H14FNO4 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | ethyl 5-ethoxy-2-(4-fluorophenyl)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(F)cc2)oc1OCC |
| InChI | InChI=1S/C14H14FNO4/c1-3-18-13(17)11-14(19-4-2)20-12(16-11)9-5-7-10(15)8-6-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | FAHOFOVQNNLKIS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |