C32H30N6O5 — CID 158160690
2-methyl-1-[4-methyl-2-(2-nitrophenyl)benzimidazol-1-yl]propan-2-ol;4-methyl-2-(2-nitrophenyl)-1H-benzimidazole (PubChem CID 158160690) has the molecular formula C32H30N6O5 and a molecular weight of 578.63 g/mol. Its IUPAC name is 2-methyl-1-[4-methyl-2-(2-nitrophenyl)benzimidazol-1-yl]propan-2-ol;4-methyl-2-(2-nitrophenyl)-1H-benzimidazole.
| Compound Name | 2-methyl-1-[4-methyl-2-(2-nitrophenyl)benzimidazol-1-yl]propan-2-ol;4-methyl-2-(2-nitrophenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 158160690 |
| Molecular Formula | C32H30N6O5 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 2-methyl-1-[4-methyl-2-(2-nitrophenyl)benzimidazol-1-yl]propan-2-ol;4-methyl-2-(2-nitrophenyl)-1H-benzimidazole |
| SMILES | Cc1cccc2[nH]c(-c3ccccc3[N+](=O)[O-])nc12.Cc1cccc2c1nc(-c1ccccc1[N+](=O)[O-])n2CC(C)(C)O |
| InChI | InChI=1S/C18H19N3O3.C14H11N3O2/c1-12-7-6-10-15-16(12)19-17(20(15)11-18(2,3)22)13-8-4-5-9-14(13)21(23)24;1-9-5-4-7-11-13(9)16-14(15-11)10-6-2-3-8-12(10)17(18)19/h4-10,22H,11H2,1-3H3;2-8H,1H3,(H,15,16) |
| InChIKey | FWFRSYAWNNLRGV-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|