C10H13F2NS — CID 158162032
2-[(Z)-4,5-difluorohex-4-enyl]-5-methyl-1,3-thiazole (PubChem CID 158162032) has the molecular formula C10H13F2NS and a molecular weight of 217.28 g/mol. Its IUPAC name is 2-[(Z)-4,5-difluorohex-4-enyl]-5-methyl-1,3-thiazole.
| Compound Name | 2-[(Z)-4,5-difluorohex-4-enyl]-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 158162032 |
| Molecular Formula | C10H13F2NS |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-[(Z)-4,5-difluorohex-4-enyl]-5-methyl-1,3-thiazole |
| SMILES | C/C(F)=C(/F)CCCc1ncc(C)s1 |
| InChI | InChI=1S/C10H13F2NS/c1-7-6-13-10(14-7)5-3-4-9(12)8(2)11/h6H,3-5H2,1-2H3/b9-8- |
| InChIKey | FWJRTJCKSXNFHA-HJWRWDBZSA-N |
| XLogP | 3.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |