C29H26BrF2N3O2 — CID 158164611
benzamide;2-(4-bromo-2-methylanilino)-3,4-difluoro-N-(2-phenylethyl)benzamide (PubChem CID 158164611) has the molecular formula C29H26BrF2N3O2 and a molecular weight of 566.45 g/mol. Its IUPAC name is benzamide;2-(4-bromo-2-methylanilino)-3,4-difluoro-N-(2-phenylethyl)benzamide.
| Compound Name | benzamide;2-(4-bromo-2-methylanilino)-3,4-difluoro-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 158164611 |
| Molecular Formula | C29H26BrF2N3O2 |
| Molecular Weight | 566.45 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | benzamide;2-(4-bromo-2-methylanilino)-3,4-difluoro-N-(2-phenylethyl)benzamide |
| SMILES | Cc1cc(Br)ccc1Nc1c(C(=O)NCCc2ccccc2)ccc(F)c1F.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19BrF2N2O.C7H7NO/c1-14-13-16(23)7-10-19(14)27-21-17(8-9-18(24)20(21)25)22(28)26-12-11-15-5-3-2-4-6-15;8-7(9)6-4-2-1-3-5-6/h2-10,13,27H,11-12H2,1H3,(H,26,28);1-5H,(H2,8,9) |
| InChIKey | FWROJNQJSQQPPP-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.45 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |