C40H41N11O2S — CID 158167794
3-[8-amino-6-(2-ethylphenyl)-2,7-naphthyridin-3-yl]-1,1-dimethylurea;1-[8-amino-6-(2-ethylphenyl)-2,7-naphthyridin-3-yl]-3-(1,3-thiazol-5-ylmethyl)urea (PubChem CID 158167794) has the molecular formula C40H41N11O2S and a molecular weight of 739.91 g/mol. Its IUPAC name is 3-[8-amino-6-(2-ethylphenyl)-2,7-naphthyridin-3-yl]-1,1-dimethylurea;1-[8-amino-6-(2-ethylphenyl)-2,7-naphthyridin-3-yl]-3-(1,3-thiazol-5-ylmethyl)urea.
| Compound Name | 3-[8-amino-6-(2-ethylphenyl)-2,7-naphthyridin-3-yl]-1,1-dimethylurea;1-[8-amino-6-(2-ethylphenyl)-2,7-naphthyridin-3-yl]-3-(1,3-thiazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 158167794 |
| Molecular Formula | C40H41N11O2S |
| Molecular Weight | 739.91 g/mol |
| Exact Mass | 739.32 |
| IUPAC Name | 3-[8-amino-6-(2-ethylphenyl)-2,7-naphthyridin-3-yl]-1,1-dimethylurea;1-[8-amino-6-(2-ethylphenyl)-2,7-naphthyridin-3-yl]-3-(1,3-thiazol-5-ylmethyl)urea |
| SMILES | CCc1ccccc1-c1cc2cc(NC(=O)N(C)C)ncc2c(N)n1.CCc1ccccc1-c1cc2cc(NC(=O)NCc3cncs3)ncc2c(N)n1 |
| InChI | InChI=1S/C21H20N6OS.C19H21N5O/c1-2-13-5-3-4-6-16(13)18-7-14-8-19(24-11-17(14)20(22)26-18)27-21(28)25-10-15-9-23-12-29-15;1-4-12-7-5-6-8-14(12)16-9-13-10-17(23-19(25)24(2)3)21-11-15(13)18(20)22-16/h3-9,11-12H,2,10H2,1H3,(H2,22,26)(H2,24,25,27,28);5-11H,4H2,1-3H3,(H2,20,22)(H,21,23,25) |
| InChIKey | FXBFKFQDOKFDBZ-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 189.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.91 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |