About N,N-dimethylfuran-2-amine;pyridine
N,N-dimethylfuran-2-amine;pyridine (PubChem CID 158170287) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is N,N-dimethylfuran-2-amine;pyridine.
Molecular Properties
| Compound Name | N,N-dimethylfuran-2-amine;pyridine |
| PubChem CID | 158170287 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N,N-dimethylfuran-2-amine;pyridine |
| SMILES | CN(C)c1ccco1.c1ccncc1 |
| InChI | InChI=1S/C6H9NO.C5H5N/c1-7(2)6-4-3-5-8-6;1-2-4-6-5-3-1/h3-5H,1-2H3;1-5H |
| InChIKey | FXJCZHQQTNEYQE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethylfuran-2-amine;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylfuran-2-amine;pyridine?
The IUPAC name of N,N-dimethylfuran-2-amine;pyridine (CID 158170287) is N,N-dimethylfuran-2-amine;pyridine.
What is the SMILES notation for N,N-dimethylfuran-2-amine;pyridine?
The canonical SMILES for N,N-dimethylfuran-2-amine;pyridine is CN(C)c1ccco1.c1ccncc1.
What is the InChIKey of N,N-dimethylfuran-2-amine;pyridine?
The InChIKey is FXJCZHQQTNEYQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C5H5N/c1-7(2)6-4-3-5-8-6;1-2-4-6-5-3-1/h3-5H,1-2H3;1-5H.
What are the key properties of N,N-dimethylfuran-2-amine;pyridine?
N,N-dimethylfuran-2-amine;pyridine has a molecular weight of 190.25 g/mol, XLogP of 2.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylfuran-2-amine;pyridine is sourced from PubChem (CID 158170287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).