C27H43NO2 — CID 158171057
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-8-(1-adamantyl)octane-1,7-dione (PubChem CID 158171057) has the molecular formula C27H43NO2 and a molecular weight of 413.65 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-8-(1-adamantyl)octane-1,7-dione.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-8-(1-adamantyl)octane-1,7-dione |
|---|---|
| PubChem CID | 158171057 |
| Molecular Formula | C27H43NO2 |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-8-(1-adamantyl)octane-1,7-dione |
| SMILES | O=C(CCCCCC(=O)N1CCCC2CCCCC21)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H43NO2/c29-24(19-27-16-20-13-21(17-27)15-22(14-20)18-27)9-2-1-3-11-26(30)28-12-6-8-23-7-4-5-10-25(23)28/h20-23,25H,1-19H2 |
| InChIKey | FXLMPOMMLXPCDU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|