C28H26F6N4O3 — CID 158178093
2-[2-[5-(2-cyclopentylethyl)-3-pyridinyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 158178093) has the molecular formula C28H26F6N4O3 and a molecular weight of 580.53 g/mol. Its IUPAC name is 2-[2-[5-(2-cyclopentylethyl)-3-pyridinyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | 2-[2-[5-(2-cyclopentylethyl)-3-pyridinyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 158178093 |
| Molecular Formula | C28H26F6N4O3 |
| Molecular Weight | 580.53 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 2-[2-[5-(2-cyclopentylethyl)-3-pyridinyl]-4-pyridinyl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | O=C(C(=O)C(F)(F)F)C(F)(F)F.O=C1NCCc2[nH]c(-c3ccnc(-c4cncc(CCC5CCCC5)c4)c3)cc21 |
| InChI | InChI=1S/C24H26N4O.C4F6O2/c29-24-20-13-23(28-21(20)8-10-27-24)18-7-9-26-22(12-18)19-11-17(14-25-15-19)6-5-16-3-1-2-4-16;5-3(6,7)1(11)2(12)4(8,9)10/h7,9,11-16,28H,1-6,8,10H2,(H,27,29); |
| InChIKey | FYFYKJKCYOEDQC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|