C36H28BBrF4N2O2 — CID 158178789
2-(3-bromophenyl)-5-methylpyridine;(2,4-difluorophenyl)boronic acid;2-[3-(2,4-difluorophenyl)phenyl]-5-methylpyridine (PubChem CID 158178789) has the molecular formula C36H28BBrF4N2O2 and a molecular weight of 687.34 g/mol. Its IUPAC name is 2-(3-bromophenyl)-5-methylpyridine;(2,4-difluorophenyl)boronic acid;2-[3-(2,4-difluorophenyl)phenyl]-5-methylpyridine.
| Compound Name | 2-(3-bromophenyl)-5-methylpyridine;(2,4-difluorophenyl)boronic acid;2-[3-(2,4-difluorophenyl)phenyl]-5-methylpyridine |
|---|---|
| PubChem CID | 158178789 |
| Molecular Formula | C36H28BBrF4N2O2 |
| Molecular Weight | 687.34 g/mol |
| Exact Mass | 686.14 |
| IUPAC Name | 2-(3-bromophenyl)-5-methylpyridine;(2,4-difluorophenyl)boronic acid;2-[3-(2,4-difluorophenyl)phenyl]-5-methylpyridine |
| SMILES | Cc1ccc(-c2cccc(-c3ccc(F)cc3F)c2)nc1.Cc1ccc(-c2cccc(Br)c2)nc1.OB(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H13F2N.C12H10BrN.C6H5BF2O2/c1-12-5-8-18(21-11-12)14-4-2-3-13(9-14)16-7-6-15(19)10-17(16)20;1-9-5-6-12(14-8-9)10-3-2-4-11(13)7-10;8-4-1-2-5(7(10)11)6(9)3-4/h2-11H,1H3;2-8H,1H3;1-3,10-11H |
| InChIKey | FYIAUTGEVWQCAW-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.34 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|