About carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol
carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol (PubChem CID 158180135) has the molecular formula C29H24N4O3
and a molecular weight of 476.54 g/mol. Its IUPAC name is carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol.
Molecular Properties
| Compound Name | carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol |
| PubChem CID | 158180135 |
| Molecular Formula | C29H24N4O3 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol |
| SMILES | Cc1ccc2ncn(-c3ccccc3)c2c1.O=C=O.OCc1ccc2ncn(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C14H12N2O.C14H12N2.CO2/c17-9-11-6-7-13-14(8-11)16(10-15-13)12-4-2-1-3-5-12;1-11-7-8-13-14(9-11)16(10-15-13)12-5-3-2-4-6-12;2-1-3/h1-8,10,17H,9H2;2-10H,1H3; |
| InChIKey | FYMGWEDCQKDSQV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol?
The IUPAC name of carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol (CID 158180135) is carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol.
What is the SMILES notation for carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol?
The canonical SMILES for carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol is Cc1ccc2ncn(-c3ccccc3)c2c1.O=C=O.OCc1ccc2ncn(-c3ccccc3)c2c1.
What is the InChIKey of carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol?
The InChIKey is FYMGWEDCQKDSQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O.C14H12N2.CO2/c17-9-11-6-7-13-14(8-11)16(10-15-13)12-4-2-1-3-5-12;1-11-7-8-13-14(9-11)16(10-15-13)12-5-3-2-4-6-12;2-1-3/h1-8,10,17H,9H2;2-10H,1H3;.
What are the key properties of carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol?
carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol has a molecular weight of 476.54 g/mol, XLogP of 5.27, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;6-methyl-1-phenylbenzimidazole;(3-phenylbenzimidazol-5-yl)methanol is sourced from PubChem (CID 158180135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).