C19H28O6P2 — CID 158181134
dihydroxyphosphanyl dihydrogen phosphite;2,2-dimethyl-1,1-bis(2-methylphenyl)propan-1-ol (PubChem CID 158181134) has the molecular formula C19H28O6P2 and a molecular weight of 414.38 g/mol. Its IUPAC name is dihydroxyphosphanyl dihydrogen phosphite;2,2-dimethyl-1,1-bis(2-methylphenyl)propan-1-ol.
| Compound Name | dihydroxyphosphanyl dihydrogen phosphite;2,2-dimethyl-1,1-bis(2-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 158181134 |
| Molecular Formula | C19H28O6P2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | dihydroxyphosphanyl dihydrogen phosphite;2,2-dimethyl-1,1-bis(2-methylphenyl)propan-1-ol |
| SMILES | Cc1ccccc1C(O)(c1ccccc1C)C(C)(C)C.OP(O)OP(O)O |
| InChI | InChI=1S/C19H24O.H4O5P2/c1-14-10-6-8-12-16(14)19(20,18(3,4)5)17-13-9-7-11-15(17)2;1-6(2)5-7(3)4/h6-13,20H,1-5H3;1-4H |
| InChIKey | FYPLUTJRJXMBOZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|