About methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine
methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine (PubChem CID 158182176) has the molecular formula C17H28N4
and a molecular weight of 288.44 g/mol. Its IUPAC name is methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine.
Molecular Properties
| Compound Name | methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine |
| PubChem CID | 158182176 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine |
| SMILES | C.CC(C)c1ccnc(N)c1.Cc1ncc(C(C)C)cn1 |
| InChI | InChI=1S/2C8H12N2.CH4/c1-6(2)8-4-9-7(3)10-5-8;1-6(2)7-3-4-10-8(9)5-7;/h4-6H,1-3H3;3-6H,1-2H3,(H2,9,10);1H4 |
| InChIKey | FYSOMYOBWDYYBJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine?
The IUPAC name of methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine (CID 158182176) is methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine.
What is the SMILES notation for methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine?
The canonical SMILES for methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine is C.CC(C)c1ccnc(N)c1.Cc1ncc(C(C)C)cn1.
What is the InChIKey of methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine?
The InChIKey is FYSOMYOBWDYYBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H12N2.CH4/c1-6(2)8-4-9-7(3)10-5-8;1-6(2)7-3-4-10-8(9)5-7;/h4-6H,1-3H3;3-6H,1-2H3,(H2,9,10);1H4.
What are the key properties of methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine?
methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine has a molecular weight of 288.44 g/mol, XLogP of 4.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methyl-5-propan-2-ylpyrimidine;4-propan-2-ylpyridin-2-amine is sourced from PubChem (CID 158182176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).