C10H18O2S — CID 158183619
(5S)-3-methylidene-5-(propylsulfanylmethyl)cyclopentane-1,2-diol (PubChem CID 158183619) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is (5S)-3-methylidene-5-(propylsulfanylmethyl)cyclopentane-1,2-diol.
| Compound Name | (5S)-3-methylidene-5-(propylsulfanylmethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 158183619 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (5S)-3-methylidene-5-(propylsulfanylmethyl)cyclopentane-1,2-diol |
| SMILES | C=C1C[C@H](CSCCC)C(O)C1O |
| InChI | InChI=1S/C10H18O2S/c1-3-4-13-6-8-5-7(2)9(11)10(8)12/h8-12H,2-6H2,1H3/t8-,9?,10?/m1/s1 |
| InChIKey | WPGYMDXPKQJNKS-XNWIYYODSA-N |
| XLogP | 1.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|