C12H24S2 — CID 69353267
1,2-bis(ethylsulfanylmethyl)cyclohexane (PubChem CID 69353267) has the molecular formula C12H24S2 and a molecular weight of 232.46 g/mol. Its IUPAC name is 1,2-bis(ethylsulfanylmethyl)cyclohexane.
| Compound Name | 1,2-bis(ethylsulfanylmethyl)cyclohexane |
|---|---|
| PubChem CID | 69353267 |
| Molecular Formula | C12H24S2 |
| Molecular Weight | 232.46 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1,2-bis(ethylsulfanylmethyl)cyclohexane |
| SMILES | CCSCC1CCCCC1CSCC |
| InChI | InChI=1S/C12H24S2/c1-3-13-9-11-7-5-6-8-12(11)10-14-4-2/h11-12H,3-10H2,1-2H3 |
| InChIKey | QDRVMTPYGVHUKV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |