C25H40N2O4 — CID 158191361
[(2S,3R,11bR)-3-(2,2-dimethylpropyl)-10-methoxy-9-(trideuteriomethoxy)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate (PubChem CID 158191361) has the molecular formula C25H40N2O4 and a molecular weight of 435.62 g/mol. Its IUPAC name is [(2S,3R,11bR)-3-(2,2-dimethylpropyl)-10-methoxy-9-(trideuteriomethoxy)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [(2S,3R,11bR)-3-(2,2-dimethylpropyl)-10-methoxy-9-(trideuteriomethoxy)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 158191361 |
| Molecular Formula | C25H40N2O4 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | [(2S,3R,11bR)-3-(2,2-dimethylpropyl)-10-methoxy-9-(trideuteriomethoxy)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate |
| SMILES | [2H]C([2H])([2H])Oc1cc2c(cc1OC)[C@H]1C[C@H](OC(=O)[C@@H](N)C(C)C)[C@H](CC(C)(C)C)CN1CC2 |
| InChI | InChI=1S/C25H40N2O4/c1-15(2)23(26)24(28)31-20-12-19-18-11-22(30-7)21(29-6)10-16(18)8-9-27(19)14-17(20)13-25(3,4)5/h10-11,15,17,19-20,23H,8-9,12-14,26H2,1-7H3/t17-,19-,20+,23+/m1/s1/i6D3 |
| InChIKey | ZWJSRRWNCVZGLB-KATTYKNISA-N |
| XLogP | 3.95 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |