C32H50N2O7S — CID 175930511
[(2R,3R,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate;1,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 175930511) has the molecular formula C32H50N2O7S and a molecular weight of 606.83 g/mol. Its IUPAC name is [(2R,3R,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate;1,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | [(2R,3R,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate;1,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 175930511 |
| Molecular Formula | C32H50N2O7S |
| Molecular Weight | 606.83 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | [(2R,3R,11bR)-9,10-dimethoxy-3-(2-methylpropyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-yl] (2S)-2-amino-3-methylbutanoate;1,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CC1C=CC=CC1(C)S(=O)(=O)O.COc1cc2c(cc1OC)[C@H]1C[C@@H](OC(=O)[C@@H](N)C(C)C)[C@H](CC(C)C)CN1CC2 |
| InChI | InChI=1S/C24H38N2O4.C8H12O3S/c1-14(2)9-17-13-26-8-7-16-10-21(28-5)22(29-6)11-18(16)19(26)12-20(17)30-24(27)23(25)15(3)4;1-7-5-3-4-6-8(7,2)12(9,10)11/h10-11,14-15,17,19-20,23H,7-9,12-13,25H2,1-6H3;3-7H,1-2H3,(H,9,10,11)/t17-,19-,20-,23+;/m1./s1 |
| InChIKey | UCFPCQGJRTUYOK-GJMBNWKXSA-N |
| XLogP | 4.96 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.83 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|