About 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine
4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine (PubChem CID 158192598) has the molecular formula C24H15BrF6N2O2
and a molecular weight of 557.29 g/mol. Its IUPAC name is 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine.
Molecular Properties
| Compound Name | 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine |
| PubChem CID | 158192598 |
| Molecular Formula | C24H15BrF6N2O2 |
| Molecular Weight | 557.29 g/mol |
| Exact Mass | 556.02 |
| IUPAC Name | 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine |
| SMILES | FC(F)(F)Oc1ccc(-c2ccncc2)cc1.FC(F)(F)Oc1ccc(-c2ccncc2)cc1Br |
| InChI | InChI=1S/C12H7BrF3NO.C12H8F3NO/c13-10-7-9(8-3-5-17-6-4-8)1-2-11(10)18-12(14,15)16;13-12(14,15)17-11-3-1-9(2-4-11)10-5-7-16-8-6-10/h1-7H;1-8H |
| InChIKey | FZYIIGXCPMDWJT-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.29 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine?
The IUPAC name of 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine (CID 158192598) is 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine.
What is the SMILES notation for 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine?
The canonical SMILES for 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine is FC(F)(F)Oc1ccc(-c2ccncc2)cc1.FC(F)(F)Oc1ccc(-c2ccncc2)cc1Br.
What is the InChIKey of 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine?
The InChIKey is FZYIIGXCPMDWJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7BrF3NO.C12H8F3NO/c13-10-7-9(8-3-5-17-6-4-8)1-2-11(10)18-12(14,15)16;13-12(14,15)17-11-3-1-9(2-4-11)10-5-7-16-8-6-10/h1-7H;1-8H.
What are the key properties of 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine?
4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine has a molecular weight of 557.29 g/mol, XLogP of 8.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-bromo-4-(trifluoromethoxy)phenyl]pyridine;4-[4-(trifluoromethoxy)phenyl]pyridine is sourced from PubChem (CID 158192598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).