About 4,4-difluoro-2H-indol-1-amine;hydrochloride
4,4-difluoro-2H-indol-1-amine;hydrochloride (PubChem CID 158200056) has the molecular formula C8H9ClF2N2
and a molecular weight of 206.62 g/mol. Its IUPAC name is 4,4-difluoro-2H-indol-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 4,4-difluoro-2H-indol-1-amine;hydrochloride |
| PubChem CID | 158200056 |
| Molecular Formula | C8H9ClF2N2 |
| Molecular Weight | 206.62 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 4,4-difluoro-2H-indol-1-amine;hydrochloride |
| SMILES | Cl.NN1CC=C2C1=CC=CC2(F)F |
| InChI | InChI=1S/C8H8F2N2.ClH/c9-8(10)4-1-2-7-6(8)3-5-12(7)11;/h1-4H,5,11H2;1H |
| InChIKey | OUKIZARMNBDVKI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.62 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoro-2H-indol-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-2H-indol-1-amine;hydrochloride?
The IUPAC name of 4,4-difluoro-2H-indol-1-amine;hydrochloride (CID 158200056) is 4,4-difluoro-2H-indol-1-amine;hydrochloride.
What is the SMILES notation for 4,4-difluoro-2H-indol-1-amine;hydrochloride?
The canonical SMILES for 4,4-difluoro-2H-indol-1-amine;hydrochloride is Cl.NN1CC=C2C1=CC=CC2(F)F.
What is the InChIKey of 4,4-difluoro-2H-indol-1-amine;hydrochloride?
The InChIKey is OUKIZARMNBDVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2N2.ClH/c9-8(10)4-1-2-7-6(8)3-5-12(7)11;/h1-4H,5,11H2;1H.
What are the key properties of 4,4-difluoro-2H-indol-1-amine;hydrochloride?
4,4-difluoro-2H-indol-1-amine;hydrochloride has a molecular weight of 206.62 g/mol, XLogP of 1.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-2H-indol-1-amine;hydrochloride is sourced from PubChem (CID 158200056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).