C8H8F2N2 — CID 158200057
4,4-difluoro-2H-indol-1-amine (PubChem CID 158200057) has the molecular formula C8H8F2N2 and a molecular weight of 170.16 g/mol. Its IUPAC name is 4,4-difluoro-2H-indol-1-amine.
| Compound Name | 4,4-difluoro-2H-indol-1-amine |
|---|---|
| PubChem CID | 158200057 |
| Molecular Formula | C8H8F2N2 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 4,4-difluoro-2H-indol-1-amine |
| SMILES | NN1CC=C2C1=CC=CC2(F)F |
| InChI | InChI=1S/C8H8F2N2/c9-8(10)4-1-2-7-6(8)3-5-12(7)11/h1-4H,5,11H2 |
| InChIKey | GAUZRSFDCUYJMR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|