C8H12N2 — CID 141130699
2,5,6,7-tetrahydrocyclopenta[b]pyridin-1-amine (PubChem CID 141130699) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2,5,6,7-tetrahydrocyclopenta[b]pyridin-1-amine.
| Compound Name | 2,5,6,7-tetrahydrocyclopenta[b]pyridin-1-amine |
|---|---|
| PubChem CID | 141130699 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2,5,6,7-tetrahydrocyclopenta[b]pyridin-1-amine |
| SMILES | NN1CC=CC2=C1CCC2 |
| InChI | InChI=1S/C8H12N2/c9-10-6-2-4-7-3-1-5-8(7)10/h2,4H,1,3,5-6,9H2 |
| InChIKey | UATYQHIGBHAOML-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|