C12H23N3 — CID 143794572
ethane;6-ethyl-1,3-dimethyl-4,5-dihydro-2H-benzotriazole (PubChem CID 143794572) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is ethane;6-ethyl-1,3-dimethyl-4,5-dihydro-2H-benzotriazole.
| Compound Name | ethane;6-ethyl-1,3-dimethyl-4,5-dihydro-2H-benzotriazole |
|---|---|
| PubChem CID | 143794572 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | ethane;6-ethyl-1,3-dimethyl-4,5-dihydro-2H-benzotriazole |
| SMILES | CC.CCC1=CC2=C(CC1)N(C)NN2C |
| InChI | InChI=1S/C10H17N3.C2H6/c1-4-8-5-6-9-10(7-8)13(3)11-12(9)2;1-2/h7,11H,4-6H2,1-3H3;1-2H3 |
| InChIKey | IYPMSZKPTRWYDA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |