C12H22N2 — CID 145152600
5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyridin-1-amine;ethane (PubChem CID 145152600) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyridin-1-amine;ethane.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyridin-1-amine;ethane |
|---|---|
| PubChem CID | 145152600 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyridin-1-amine;ethane |
| SMILES | C=C/C=C\C1=C(C)N(N)CCC1.CC |
| InChI | InChI=1S/C10H16N2.C2H6/c1-3-4-6-10-7-5-8-12(11)9(10)2;1-2/h3-4,6H,1,5,7-8,11H2,2H3;1-2H3/b6-4-; |
| InChIKey | KZANQYOBFJBKBW-YHSAGPEESA-N |
| XLogP | 3.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|