C9H14N2 — CID 88988157
3,4,5,6-tetrahydro-2H-quinolin-1-amine (PubChem CID 88988157) has the molecular formula C9H14N2 and a molecular weight of 150.23 g/mol. Its IUPAC name is 3,4,5,6-tetrahydro-2H-quinolin-1-amine.
| Compound Name | 3,4,5,6-tetrahydro-2H-quinolin-1-amine |
|---|---|
| PubChem CID | 88988157 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.23 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 3,4,5,6-tetrahydro-2H-quinolin-1-amine |
| SMILES | NN1CCCC2=C1C=CCC2 |
| InChI | InChI=1S/C9H14N2/c10-11-7-3-5-8-4-1-2-6-9(8)11/h2,6H,1,3-5,7,10H2 |
| InChIKey | KJRYRTDPFBWGFP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|