C9H12IN — CID 118190427
1-iodo-3,4,5,6-tetrahydro-2H-quinoline (PubChem CID 118190427) has the molecular formula C9H12IN and a molecular weight of 261.11 g/mol. Its IUPAC name is 1-iodo-3,4,5,6-tetrahydro-2H-quinoline.
| Compound Name | 1-iodo-3,4,5,6-tetrahydro-2H-quinoline |
|---|---|
| PubChem CID | 118190427 |
| Molecular Formula | C9H12IN |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 1-iodo-3,4,5,6-tetrahydro-2H-quinoline |
| SMILES | IN1CCCC2=C1C=CCC2 |
| InChI | InChI=1S/C9H12IN/c10-11-7-3-5-8-4-1-2-6-9(8)11/h2,6H,1,3-5,7H2 |
| InChIKey | CIFBHJXLRURNTO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|