C10H15N — CID 68201904
2-Methyl-1,2,5,6,7,8-hexahydroquinoline (PubChem CID 68201904) has the molecular formula C10H15N and a molecular weight of 149.23 g/mol. Its IUPAC name is 2-methyl-1,2,5,6,7,8-hexahydroquinoline.
| Compound Name | 2-Methyl-1,2,5,6,7,8-hexahydroquinoline |
|---|---|
| PubChem CID | 68201904 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.23 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 2-methyl-1,2,5,6,7,8-hexahydroquinoline |
| SMILES | CC1C=CC2=C(N1)CCCC2 |
| InChI | InChI=1S/C10H15N/c1-8-6-7-9-4-2-3-5-10(9)11-8/h6-8,11H,2-5H2,1H3 |
| InChIKey | SDRQJAPYZYDOHW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 213 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |