About Tetrahydro 2h phenanthridin
Tetrahydro 2h phenanthridin (PubChem CID 21749136) has the molecular formula C13H15N
and a molecular weight of 185.26 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrophenanthridine.
Molecular Properties
| Compound Name | Tetrahydro 2h phenanthridin |
| PubChem CID | 21749136 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.26 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrophenanthridine |
| SMILES | C1CCC2=C3C=CC=CC3=CNC2C1 |
| InChI | InChI=1S/C13H15N/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-2,5-6,9,13-14H,3-4,7-8H2 |
| InChIKey | OPXQOTUWFKHYCC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | 369 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Tetrahydro 2h phenanthridin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tetrahydro 2h phenanthridin?
The IUPAC name of Tetrahydro 2h phenanthridin (CID 21749136) is 1,2,3,4,4a,5-hexahydrophenanthridine.
What is the SMILES notation for Tetrahydro 2h phenanthridin?
The canonical SMILES for Tetrahydro 2h phenanthridin is C1CCC2=C3C=CC=CC3=CNC2C1.
What is the InChIKey of Tetrahydro 2h phenanthridin?
The InChIKey is OPXQOTUWFKHYCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-2,5-6,9,13-14H,3-4,7-8H2.
What are the key properties of Tetrahydro 2h phenanthridin?
Tetrahydro 2h phenanthridin has a molecular weight of 185.26 g/mol, XLogP of 2.40, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Tetrahydro 2h phenanthridin is sourced from PubChem (CID 21749136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).