About Octahydrophenanthridine
Octahydrophenanthridine (PubChem CID 21749135) has the molecular formula C13H17N
and a molecular weight of 187.28 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,6a-octahydrophenanthridine.
Molecular Properties
| Compound Name | Octahydrophenanthridine |
| PubChem CID | 21749135 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1,2,3,4,4a,5,6,6a-octahydrophenanthridine |
| SMILES | C1CCC2=C3C=CC=CC3CNC2C1 |
| InChI | InChI=1S/C13H17N/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-2,5-6,10,13-14H,3-4,7-9H2 |
| InChIKey | VSTAXSUDMQVBOF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | 322 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Octahydrophenanthridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Octahydrophenanthridine?
The IUPAC name of Octahydrophenanthridine (CID 21749135) is 1,2,3,4,4a,5,6,6a-octahydrophenanthridine.
What is the SMILES notation for Octahydrophenanthridine?
The canonical SMILES for Octahydrophenanthridine is C1CCC2=C3C=CC=CC3CNC2C1.
What is the InChIKey of Octahydrophenanthridine?
The InChIKey is VSTAXSUDMQVBOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-2-6-11-10(5-1)9-14-13-8-4-3-7-12(11)13/h1-2,5-6,10,13-14H,3-4,7-9H2.
What are the key properties of Octahydrophenanthridine?
Octahydrophenanthridine has a molecular weight of 187.28 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Octahydrophenanthridine is sourced from PubChem (CID 21749135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).