C11H22N2 — CID 145152677
ethane;6-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyridin-1-amine (PubChem CID 145152677) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;6-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyridin-1-amine.
| Compound Name | ethane;6-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyridin-1-amine |
|---|---|
| PubChem CID | 145152677 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | ethane;6-methyl-5-[(Z)-prop-1-enyl]-3,4-dihydro-2H-pyridin-1-amine |
| SMILES | C/C=C\C1=C(C)N(N)CCC1.CC |
| InChI | InChI=1S/C9H16N2.C2H6/c1-3-5-9-6-4-7-11(10)8(9)2;1-2/h3,5H,4,6-7,10H2,1-2H3;1-2H3/b5-3-; |
| InChIKey | GPAAEPHLQAVFJJ-FBZPGIPVSA-N |
| XLogP | 2.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|