C27H24F4N2O4S — CID 158200889
1-[(3aR,5S,6aS)-4-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-3-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]propan-1-one (PubChem CID 158200889) has the molecular formula C27H24F4N2O4S and a molecular weight of 548.56 g/mol. Its IUPAC name is 1-[(3aR,5S,6aS)-4-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-3-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]propan-1-one.
| Compound Name | 1-[(3aR,5S,6aS)-4-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-3-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 158200889 |
| Molecular Formula | C27H24F4N2O4S |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 1-[(3aR,5S,6aS)-4-(4-fluorophenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-yl]-3-[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]propan-1-one |
| SMILES | O=C(CCc1cc(-c2ccc(C(F)(F)F)cc2)ncn1)[C@@H]1C[C@@H]2COC[C@@H]2C1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H24F4N2O4S/c28-19-5-8-21(9-6-19)38(35,36)26-22(11-17-13-37-14-23(17)26)25(34)10-7-20-12-24(33-15-32-20)16-1-3-18(4-2-16)27(29,30)31/h1-6,8-9,12,15,17,22-23,26H,7,10-11,13-14H2/t17-,22+,23+,26?/m1/s1 |
| InChIKey | QJLCJMRDNLVOAS-TXVORKFQSA-N |
| XLogP | 4.93 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |