C26H23F4N3O4S — CID 134474790
(3aR,5R,6aS)-4-(4-fluorophenyl)sulfonyl-N-[[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-carboxamide (PubChem CID 134474790) has the molecular formula C26H23F4N3O4S and a molecular weight of 549.55 g/mol. Its IUPAC name is (3aR,5R,6aS)-4-(4-fluorophenyl)sulfonyl-N-[[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-carboxamide.
| Compound Name | (3aR,5R,6aS)-4-(4-fluorophenyl)sulfonyl-N-[[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-carboxamide |
|---|---|
| PubChem CID | 134474790 |
| Molecular Formula | C26H23F4N3O4S |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | (3aR,5R,6aS)-4-(4-fluorophenyl)sulfonyl-N-[[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]furan-5-carboxamide |
| SMILES | O=C(NCc1cc(-c2ccc(C(F)(F)F)cc2)ncn1)[C@H]1C[C@@H]2COC[C@@H]2C1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H23F4N3O4S/c27-18-5-7-20(8-6-18)38(35,36)24-21(9-16-12-37-13-22(16)24)25(34)31-11-19-10-23(33-14-32-19)15-1-3-17(4-2-15)26(28,29)30/h1-8,10,14,16,21-22,24H,9,11-13H2,(H,31,34)/t16-,21+,22+,24?/m1/s1 |
| InChIKey | CJRKPMAXMPUREV-GBZAFQQSSA-N |
| XLogP | 4.04 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |