C27H26F3N3O4S — CID 159718744
1-[(2R,3aS,6aR)-1-(4-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]-3-[6-[4-(1,1-difluoroethyl)phenyl]pyrimidin-4-yl]propan-1-one (PubChem CID 159718744) has the molecular formula C27H26F3N3O4S and a molecular weight of 545.58 g/mol. Its IUPAC name is 1-[(2R,3aS,6aR)-1-(4-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]-3-[6-[4-(1,1-difluoroethyl)phenyl]pyrimidin-4-yl]propan-1-one.
| Compound Name | 1-[(2R,3aS,6aR)-1-(4-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]-3-[6-[4-(1,1-difluoroethyl)phenyl]pyrimidin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 159718744 |
| Molecular Formula | C27H26F3N3O4S |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | 1-[(2R,3aS,6aR)-1-(4-fluorophenyl)sulfonyl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-2-yl]-3-[6-[4-(1,1-difluoroethyl)phenyl]pyrimidin-4-yl]propan-1-one |
| SMILES | CC(F)(F)c1ccc(-c2cc(CCC(=O)[C@H]3C[C@@H]4COC[C@@H]4N3S(=O)(=O)c3ccc(F)cc3)ncn2)cc1 |
| InChI | InChI=1S/C27H26F3N3O4S/c1-27(29,30)19-4-2-17(3-5-19)23-13-21(31-16-32-23)8-11-26(34)24-12-18-14-37-15-25(18)33(24)38(35,36)22-9-6-20(28)7-10-22/h2-7,9-10,13,16,18,24-25H,8,11-12,14-15H2,1H3/t18-,24-,25+/m1/s1 |
| InChIKey | MZTLCMUEHPWBKM-XYHYBEPMSA-N |
| XLogP | 4.37 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |