C25H22F4N4O4S — CID 123687865
1-(4-fluorophenyl)sulfonyl-N-[[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxamide (PubChem CID 123687865) has the molecular formula C25H22F4N4O4S and a molecular weight of 550.53 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 123687865 |
| Molecular Formula | C25H22F4N4O4S |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[[6-[4-(trifluoromethyl)phenyl]pyrimidin-4-yl]methyl]-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole-2-carboxamide |
| SMILES | O=C(NCc1cc(-c2ccc(C(F)(F)F)cc2)ncn1)C1CC2COCC2N1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H22F4N4O4S/c26-18-5-7-20(8-6-18)38(35,36)33-22(9-16-12-37-13-23(16)33)24(34)30-11-19-10-21(32-14-31-19)15-1-3-17(4-2-15)25(27,28)29/h1-8,10,14,16,22-23H,9,11-13H2,(H,30,34) |
| InChIKey | SEGWTDQQCHLCHX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |